![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| Majster in Jugoslovanska zvezda.JPG | 2009-04-27 16:35 | 79K | |
| Nemški transparent.JPG | 2009-04-27 16:35 | 131K | |
| Trg OF.JPG | 2009-04-27 16:35 | 70K | |
| Trg OF 2.JPG | 2009-04-27 16:35 | 107K | |
| Trg OF 3.JPG | 2009-04-27 16:35 | 88K | |
| Veteran.JPG | 2009-04-27 16:35 | 115K | |
| Veteran 2.JPG | 2009-04-27 16:35 | 143K | |
| Veteran 3.JPG | 2009-04-27 16:35 | 155K | |
| Veteran in Zastava.JPG | 2009-04-27 16:35 | 163K | |
| Zastava.JPG | 2009-04-27 16:35 | 132K | |
| s Trg OF 2.JPG | 2009-04-27 22:35 | 18K | |
| pictures.php | 2009-04-30 20:52 | 532 | |